C12H10ClN3O4 — CID 81497583
6-chloro-2-(4-ethoxycarbonylpyrazol-1-yl)pyridine-3-carboxylic acid (PubChem CID 81497583) has the molecular formula C12H10ClN3O4 and a molecular weight of 295.68 g/mol. Its IUPAC name is 6-chloro-2-(4-ethoxycarbonylpyrazol-1-yl)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(4-ethoxycarbonylpyrazol-1-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81497583 |
| Molecular Formula | C12H10ClN3O4 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 6-chloro-2-(4-ethoxycarbonylpyrazol-1-yl)pyridine-3-carboxylic acid |
| SMILES | CCOC(=O)c1cnn(-c2nc(Cl)ccc2C(=O)O)c1 |
| InChI | InChI=1S/C12H10ClN3O4/c1-2-20-12(19)7-5-14-16(6-7)10-8(11(17)18)3-4-9(13)15-10/h3-6H,2H2,1H3,(H,17,18) |
| InChIKey | OEFGUDIEICZDAF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|