C13H12F4N4 — CID 81498108
2-fluoro-6-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline (PubChem CID 81498108) has the molecular formula C13H12F4N4 and a molecular weight of 300.26 g/mol. Its IUPAC name is 2-fluoro-6-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline.
| Compound Name | 2-fluoro-6-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline |
|---|---|
| PubChem CID | 81498108 |
| Molecular Formula | C13H12F4N4 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-fluoro-6-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline |
| SMILES | Nc1c(F)cccc1-c1nnc2n1CC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C13H12F4N4/c14-9-3-1-2-8(11(9)18)12-20-19-10-5-4-7(6-21(10)12)13(15,16)17/h1-3,7H,4-6,18H2 |
| InChIKey | WHPGVSPYCRBNPM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|