About N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine
N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine (PubChem CID 81498673) has the molecular formula C15H28N2S
and a molecular weight of 268.47 g/mol. Its IUPAC name is N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine |
| PubChem CID | 81498673 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CN(C)CCCCNCc1ccc(C(C)(C)C)s1 |
| InChI | InChI=1S/C15H28N2S/c1-15(2,3)14-9-8-13(18-14)12-16-10-6-7-11-17(4)5/h8-9,16H,6-7,10-12H2,1-5H3 |
| InChIKey | ONRRXZOWGBDTTP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine?
The IUPAC name of N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine (CID 81498673) is N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine.
What is the SMILES notation for N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine?
The canonical SMILES for N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine is CN(C)CCCCNCc1ccc(C(C)(C)C)s1.
What is the InChIKey of N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine?
The InChIKey is ONRRXZOWGBDTTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2S/c1-15(2,3)14-9-8-13(18-14)12-16-10-6-7-11-17(4)5/h8-9,16H,6-7,10-12H2,1-5H3.
What are the key properties of N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine?
N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine has a molecular weight of 268.47 g/mol, XLogP of 3.48, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-tert-butylthiophen-2-yl)methyl]-N',N'-dimethylbutane-1,4-diamine is sourced from PubChem (CID 81498673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).