C15H18BrFN2OS — CID 81499388
N-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-2-bromo-3-fluorobenzamide (PubChem CID 81499388) has the molecular formula C15H18BrFN2OS and a molecular weight of 373.29 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-2-bromo-3-fluorobenzamide.
| Compound Name | N-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-2-bromo-3-fluorobenzamide |
|---|---|
| PubChem CID | 81499388 |
| Molecular Formula | C15H18BrFN2OS |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | N-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-2-bromo-3-fluorobenzamide |
| SMILES | NC(=S)C(NC(=O)c1cccc(F)c1Br)C1CCCCC1 |
| InChI | InChI=1S/C15H18BrFN2OS/c16-12-10(7-4-8-11(12)17)15(20)19-13(14(18)21)9-5-2-1-3-6-9/h4,7-9,13H,1-3,5-6H2,(H2,18,21)(H,19,20) |
| InChIKey | NJBRSRHLFRBLSC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|