C14H17Cl2NOS — CID 816075
2,2-dichloro-1-[(2S)-2-(4-propan-2-ylphenyl)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 816075) has the molecular formula C14H17Cl2NOS and a molecular weight of 318.27 g/mol. Its IUPAC name is 2,2-dichloro-1-[(2S)-2-(4-propan-2-ylphenyl)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[(2S)-2-(4-propan-2-ylphenyl)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 816075 |
| Molecular Formula | C14H17Cl2NOS |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2,2-dichloro-1-[(2S)-2-(4-propan-2-ylphenyl)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | CC(C)c1ccc([C@@H]2SCCN2C(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H17Cl2NOS/c1-9(2)10-3-5-11(6-4-10)14-17(7-8-19-14)13(18)12(15)16/h3-6,9,12,14H,7-8H2,1-2H3/t14-/m0/s1 |
| InChIKey | HIRBZPAAIUFBFB-AWEZNQCLSA-N |
| XLogP | 4.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|