About undecan-2-one
undecan-2-one (PubChem CID 8163) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is undecan-2-one.
Molecular Properties
| Compound Name | undecan-2-one |
| PubChem CID | 8163 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | undecan-2-one |
| SMILES | CCCCCCCCCC(C)=O |
| InChI | InChI=1S/C11H22O/c1-3-4-5-6-7-8-9-10-11(2)12/h3-10H2,1-2H3 |
| InChIKey | KYWIYKKSMDLRDC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-2-one?
The IUPAC name of undecan-2-one (CID 8163) is undecan-2-one.
What is the SMILES notation for undecan-2-one?
The canonical SMILES for undecan-2-one is CCCCCCCCCC(C)=O.
What is the InChIKey of undecan-2-one?
The InChIKey is KYWIYKKSMDLRDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-3-4-5-6-7-8-9-10-11(2)12/h3-10H2,1-2H3.
What are the key properties of undecan-2-one?
undecan-2-one has a molecular weight of 170.30 g/mol, XLogP of 3.72, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-2-one is sourced from PubChem (CID 8163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).