C17H17N3OS — CID 816364
3-[(2,4-dimethylanilino)methyl]-5-phenyl-1,3,4-oxadiazole-2-thione (PubChem CID 816364) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 3-[(2,4-dimethylanilino)methyl]-5-phenyl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(2,4-dimethylanilino)methyl]-5-phenyl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 816364 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[(2,4-dimethylanilino)methyl]-5-phenyl-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ccc(NCn2nc(-c3ccccc3)oc2=S)c(C)c1 |
| InChI | InChI=1S/C17H17N3OS/c1-12-8-9-15(13(2)10-12)18-11-20-17(22)21-16(19-20)14-6-4-3-5-7-14/h3-10,18H,11H2,1-2H3 |
| InChIKey | BYJSASYGQRADLP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|