C9H7Cl2N5O — CID 816658
1-(3,4-dichlorophenyl)-3-(1,2,4-triazol-4-yl)urea (PubChem CID 816658) has the molecular formula C9H7Cl2N5O and a molecular weight of 272.10 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(1,2,4-triazol-4-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(1,2,4-triazol-4-yl)urea |
|---|---|
| PubChem CID | 816658 |
| Molecular Formula | C9H7Cl2N5O |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(1,2,4-triazol-4-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nn1cnnc1 |
| InChI | InChI=1S/C9H7Cl2N5O/c10-7-2-1-6(3-8(7)11)14-9(17)15-16-4-12-13-5-16/h1-5H,(H2,14,15,17) |
| InChIKey | ADESXOBKNPNEBE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |