4-methoxy-2,6-dimethylbenzoic acid

C10H12O3 — CID 816764

IUPAC4-methoxy-2,6-dimethylbenzoic acid
SMILESCOc1cc(C)c(C(=O)O)c(C)c1
InChIInChI=1S/C10H12O3/c1-6-4-8(13-3)5-7(2)9(6)10(11)12/h4-5H,1-3H3,(H,11,12)
InChIKeyGFWRERVOFRPXKB-UHFFFAOYSA-N
MW180.20 g/mol
LogP2.01
Rot. Bonds2

About 4-methoxy-2,6-dimethylbenzoic acid

4-methoxy-2,6-dimethylbenzoic acid (PubChem CID 816764) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 4-methoxy-2,6-dimethylbenzoic acid.

Molecular Properties

Compound Name4-methoxy-2,6-dimethylbenzoic acid
PubChem CID816764
Molecular FormulaC10H12O3
Molecular Weight180.20 g/mol
Exact Mass180.08
IUPAC Name4-methoxy-2,6-dimethylbenzoic acid
SMILESCOc1cc(C)c(C(=O)O)c(C)c1
InChIInChI=1S/C10H12O3/c1-6-4-8(13-3)5-7(2)9(6)10(11)12/h4-5H,1-3H3,(H,11,12)
InChIKeyGFWRERVOFRPXKB-UHFFFAOYSA-N
XLogP2.01
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.20
LogP ≤ 52.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-methoxy-2,6-dimethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxy-2,6-dimethylbenzoic acid?
The IUPAC name of 4-methoxy-2,6-dimethylbenzoic acid (CID 816764) is 4-methoxy-2,6-dimethylbenzoic acid.
What is the SMILES notation for 4-methoxy-2,6-dimethylbenzoic acid?
The canonical SMILES for 4-methoxy-2,6-dimethylbenzoic acid is COc1cc(C)c(C(=O)O)c(C)c1.
What is the InChIKey of 4-methoxy-2,6-dimethylbenzoic acid?
The InChIKey is GFWRERVOFRPXKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-6-4-8(13-3)5-7(2)9(6)10(11)12/h4-5H,1-3H3,(H,11,12).
What are the key properties of 4-methoxy-2,6-dimethylbenzoic acid?
4-methoxy-2,6-dimethylbenzoic acid has a molecular weight of 180.20 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,6-dimethylbenzoic acid is sourced from PubChem (CID 816764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).