About 6-methoxypyrimidine-2,4-diamine
6-methoxypyrimidine-2,4-diamine (PubChem CID 816925) has the molecular formula C5H8N4O
and a molecular weight of 140.15 g/mol. Its IUPAC name is 6-methoxypyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-methoxypyrimidine-2,4-diamine |
| PubChem CID | 816925 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 6-methoxypyrimidine-2,4-diamine |
| SMILES | COc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C5H8N4O/c1-10-4-2-3(6)8-5(7)9-4/h2H,1H3,(H4,6,7,8,9) |
| InChIKey | OSBMJXWHJWWZJP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methoxypyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxypyrimidine-2,4-diamine?
The IUPAC name of 6-methoxypyrimidine-2,4-diamine (CID 816925) is 6-methoxypyrimidine-2,4-diamine.
What is the SMILES notation for 6-methoxypyrimidine-2,4-diamine?
The canonical SMILES for 6-methoxypyrimidine-2,4-diamine is COc1cc(N)nc(N)n1.
What is the InChIKey of 6-methoxypyrimidine-2,4-diamine?
The InChIKey is OSBMJXWHJWWZJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O/c1-10-4-2-3(6)8-5(7)9-4/h2H,1H3,(H4,6,7,8,9).
What are the key properties of 6-methoxypyrimidine-2,4-diamine?
6-methoxypyrimidine-2,4-diamine has a molecular weight of 140.15 g/mol, XLogP of -0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxypyrimidine-2,4-diamine is sourced from PubChem (CID 816925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).