About 5-amino-1,3,6-trimethylpyrimidine-2,4-dione
5-amino-1,3,6-trimethylpyrimidine-2,4-dione (PubChem CID 816935) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-amino-1,3,6-trimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-amino-1,3,6-trimethylpyrimidine-2,4-dione |
| PubChem CID | 816935 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 5-amino-1,3,6-trimethylpyrimidine-2,4-dione |
| SMILES | Cc1c(N)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C7H11N3O2/c1-4-5(8)6(11)10(3)7(12)9(4)2/h8H2,1-3H3 |
| InChIKey | FDKLGFYAEDLCNA-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-1,3,6-trimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,3,6-trimethylpyrimidine-2,4-dione?
The IUPAC name of 5-amino-1,3,6-trimethylpyrimidine-2,4-dione (CID 816935) is 5-amino-1,3,6-trimethylpyrimidine-2,4-dione.
What is the SMILES notation for 5-amino-1,3,6-trimethylpyrimidine-2,4-dione?
The canonical SMILES for 5-amino-1,3,6-trimethylpyrimidine-2,4-dione is Cc1c(N)c(=O)n(C)c(=O)n1C.
What is the InChIKey of 5-amino-1,3,6-trimethylpyrimidine-2,4-dione?
The InChIKey is FDKLGFYAEDLCNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-4-5(8)6(11)10(3)7(12)9(4)2/h8H2,1-3H3.
What are the key properties of 5-amino-1,3,6-trimethylpyrimidine-2,4-dione?
5-amino-1,3,6-trimethylpyrimidine-2,4-dione has a molecular weight of 169.18 g/mol, XLogP of -1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3,6-trimethylpyrimidine-2,4-dione is sourced from PubChem (CID 816935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).