About 4-N-methylpyrimidine-4,5,6-triamine
4-N-methylpyrimidine-4,5,6-triamine (PubChem CID 816958) has the molecular formula C5H9N5
and a molecular weight of 139.16 g/mol. Its IUPAC name is 4-N-methylpyrimidine-4,5,6-triamine.
Molecular Properties
| Compound Name | 4-N-methylpyrimidine-4,5,6-triamine |
| PubChem CID | 816958 |
| Molecular Formula | C5H9N5 |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 4-N-methylpyrimidine-4,5,6-triamine |
| SMILES | CNc1ncnc(N)c1N |
| InChI | InChI=1S/C5H9N5/c1-8-5-3(6)4(7)9-2-10-5/h2H,6H2,1H3,(H3,7,8,9,10) |
| InChIKey | PNMBONWGJZRFCL-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-methylpyrimidine-4,5,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methylpyrimidine-4,5,6-triamine?
The IUPAC name of 4-N-methylpyrimidine-4,5,6-triamine (CID 816958) is 4-N-methylpyrimidine-4,5,6-triamine.
What is the SMILES notation for 4-N-methylpyrimidine-4,5,6-triamine?
The canonical SMILES for 4-N-methylpyrimidine-4,5,6-triamine is CNc1ncnc(N)c1N.
What is the InChIKey of 4-N-methylpyrimidine-4,5,6-triamine?
The InChIKey is PNMBONWGJZRFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5/c1-8-5-3(6)4(7)9-2-10-5/h2H,6H2,1H3,(H3,7,8,9,10).
What are the key properties of 4-N-methylpyrimidine-4,5,6-triamine?
4-N-methylpyrimidine-4,5,6-triamine has a molecular weight of 139.16 g/mol, XLogP of -0.32, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methylpyrimidine-4,5,6-triamine is sourced from PubChem (CID 816958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).