About N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide
N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide (PubChem CID 816964) has the molecular formula C10H11N3OS
and a molecular weight of 221.28 g/mol. Its IUPAC name is N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide |
| PubChem CID | 816964 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide |
| SMILES | CC(=O)Nc1cc2nc(N)sc2cc1C |
| InChI | InChI=1S/C10H11N3OS/c1-5-3-9-8(13-10(11)15-9)4-7(5)12-6(2)14/h3-4H,1-2H3,(H2,11,13)(H,12,14) |
| InChIKey | DUWIACCTNKYBNV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide?
The IUPAC name of N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide (CID 816964) is N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide.
What is the SMILES notation for N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide?
The canonical SMILES for N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide is CC(=O)Nc1cc2nc(N)sc2cc1C.
What is the InChIKey of N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide?
The InChIKey is DUWIACCTNKYBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS/c1-5-3-9-8(13-10(11)15-9)4-7(5)12-6(2)14/h3-4H,1-2H3,(H2,11,13)(H,12,14).
What are the key properties of N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide?
N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide has a molecular weight of 221.28 g/mol, XLogP of 2.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-6-methyl-1,3-benzothiazol-5-yl)acetamide is sourced from PubChem (CID 816964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).