C21H28O2S — CID 817081
(4aS,8aS)-1-(benzenesulfinylmethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde (PubChem CID 817081) has the molecular formula C21H28O2S and a molecular weight of 344.52 g/mol. Its IUPAC name is (4aS,8aS)-1-(benzenesulfinylmethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde.
| Compound Name | (4aS,8aS)-1-(benzenesulfinylmethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 817081 |
| Molecular Formula | C21H28O2S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (4aS,8aS)-1-(benzenesulfinylmethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde |
| SMILES | CC1(C)CCC[C@]2(C)C(CS(=O)c3ccccc3)=C(C=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H28O2S/c1-20(2)12-7-13-21(3)18(16(14-22)10-11-19(20)21)15-24(23)17-8-5-4-6-9-17/h4-6,8-9,14,19H,7,10-13,15H2,1-3H3/t19-,21+,24?/m0/s1 |
| InChIKey | BRLBABVJUBZFID-WXFOFVMLSA-N |
| XLogP | 4.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|