About 2,3-dibromopyridine
2,3-dibromopyridine (PubChem CID 817102) has the molecular formula C5H3Br2N
and a molecular weight of 236.89 g/mol. Its IUPAC name is 2,3-dibromopyridine.
Molecular Properties
| Compound Name | 2,3-dibromopyridine |
| PubChem CID | 817102 |
| Molecular Formula | C5H3Br2N |
| Molecular Weight | 236.89 g/mol |
| Exact Mass | 234.86 |
| IUPAC Name | 2,3-dibromopyridine |
| SMILES | Brc1cccnc1Br |
| InChI | InChI=1S/C5H3Br2N/c6-4-2-1-3-8-5(4)7/h1-3H |
| InChIKey | SLMHHOVQRSSRCV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.89 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromopyridine?
The IUPAC name of 2,3-dibromopyridine (CID 817102) is 2,3-dibromopyridine.
What is the SMILES notation for 2,3-dibromopyridine?
The canonical SMILES for 2,3-dibromopyridine is Brc1cccnc1Br.
What is the InChIKey of 2,3-dibromopyridine?
The InChIKey is SLMHHOVQRSSRCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Br2N/c6-4-2-1-3-8-5(4)7/h1-3H.
What are the key properties of 2,3-dibromopyridine?
2,3-dibromopyridine has a molecular weight of 236.89 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromopyridine is sourced from PubChem (CID 817102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).