About 4-bromo-1H-pyridin-2-one
4-bromo-1H-pyridin-2-one (PubChem CID 817115) has the molecular formula C5H4BrNO
and a molecular weight of 174.00 g/mol. Its IUPAC name is 4-bromo-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-bromo-1H-pyridin-2-one |
| PubChem CID | 817115 |
| Molecular Formula | C5H4BrNO |
| Molecular Weight | 174.00 g/mol |
| Exact Mass | 172.95 |
| IUPAC Name | 4-bromo-1H-pyridin-2-one |
| SMILES | O=c1cc(Br)cc[nH]1 |
| InChI | InChI=1S/C5H4BrNO/c6-4-1-2-7-5(8)3-4/h1-3H,(H,7,8) |
| InChIKey | SSLMGOKTIUIZLY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.00 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1H-pyridin-2-one?
The IUPAC name of 4-bromo-1H-pyridin-2-one (CID 817115) is 4-bromo-1H-pyridin-2-one.
What is the SMILES notation for 4-bromo-1H-pyridin-2-one?
The canonical SMILES for 4-bromo-1H-pyridin-2-one is O=c1cc(Br)cc[nH]1.
What is the InChIKey of 4-bromo-1H-pyridin-2-one?
The InChIKey is SSLMGOKTIUIZLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrNO/c6-4-1-2-7-5(8)3-4/h1-3H,(H,7,8).
What are the key properties of 4-bromo-1H-pyridin-2-one?
4-bromo-1H-pyridin-2-one has a molecular weight of 174.00 g/mol, XLogP of 1.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1H-pyridin-2-one is sourced from PubChem (CID 817115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).