About 4-amino-3,5-dibromobenzaldehyde
4-amino-3,5-dibromobenzaldehyde (PubChem CID 817210) has the molecular formula C7H5Br2NO
and a molecular weight of 278.93 g/mol. Its IUPAC name is 4-amino-3,5-dibromobenzaldehyde.
Molecular Properties
| Compound Name | 4-amino-3,5-dibromobenzaldehyde |
| PubChem CID | 817210 |
| Molecular Formula | C7H5Br2NO |
| Molecular Weight | 278.93 g/mol |
| Exact Mass | 276.87 |
| IUPAC Name | 4-amino-3,5-dibromobenzaldehyde |
| SMILES | Nc1c(Br)cc(C=O)cc1Br |
| InChI | InChI=1S/C7H5Br2NO/c8-5-1-4(3-11)2-6(9)7(5)10/h1-3H,10H2 |
| InChIKey | QHFGYJWGASPRHW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.93 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5-dibromobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5-dibromobenzaldehyde?
The IUPAC name of 4-amino-3,5-dibromobenzaldehyde (CID 817210) is 4-amino-3,5-dibromobenzaldehyde.
What is the SMILES notation for 4-amino-3,5-dibromobenzaldehyde?
The canonical SMILES for 4-amino-3,5-dibromobenzaldehyde is Nc1c(Br)cc(C=O)cc1Br.
What is the InChIKey of 4-amino-3,5-dibromobenzaldehyde?
The InChIKey is QHFGYJWGASPRHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Br2NO/c8-5-1-4(3-11)2-6(9)7(5)10/h1-3H,10H2.
What are the key properties of 4-amino-3,5-dibromobenzaldehyde?
4-amino-3,5-dibromobenzaldehyde has a molecular weight of 278.93 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5-dibromobenzaldehyde is sourced from PubChem (CID 817210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).