About 4-chloroquinolin-3-amine
4-chloroquinolin-3-amine (PubChem CID 817332) has the molecular formula C9H7ClN2
and a molecular weight of 178.62 g/mol. Its IUPAC name is 4-chloroquinolin-3-amine.
Molecular Properties
| Compound Name | 4-chloroquinolin-3-amine |
| PubChem CID | 817332 |
| Molecular Formula | C9H7ClN2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 4-chloroquinolin-3-amine |
| SMILES | Nc1cnc2ccccc2c1Cl |
| InChI | InChI=1S/C9H7ClN2/c10-9-6-3-1-2-4-8(6)12-5-7(9)11/h1-5H,11H2 |
| InChIKey | FWICNGJRPKVYQV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloroquinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloroquinolin-3-amine?
The IUPAC name of 4-chloroquinolin-3-amine (CID 817332) is 4-chloroquinolin-3-amine.
What is the SMILES notation for 4-chloroquinolin-3-amine?
The canonical SMILES for 4-chloroquinolin-3-amine is Nc1cnc2ccccc2c1Cl.
What is the InChIKey of 4-chloroquinolin-3-amine?
The InChIKey is FWICNGJRPKVYQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2/c10-9-6-3-1-2-4-8(6)12-5-7(9)11/h1-5H,11H2.
What are the key properties of 4-chloroquinolin-3-amine?
4-chloroquinolin-3-amine has a molecular weight of 178.62 g/mol, XLogP of 2.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloroquinolin-3-amine is sourced from PubChem (CID 817332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).