About 2,6-dibromopyridin-3-amine
2,6-dibromopyridin-3-amine (PubChem CID 817678) has the molecular formula C5H4Br2N2
and a molecular weight of 251.91 g/mol. Its IUPAC name is 2,6-dibromopyridin-3-amine.
Molecular Properties
| Compound Name | 2,6-dibromopyridin-3-amine |
| PubChem CID | 817678 |
| Molecular Formula | C5H4Br2N2 |
| Molecular Weight | 251.91 g/mol |
| Exact Mass | 249.87 |
| IUPAC Name | 2,6-dibromopyridin-3-amine |
| SMILES | Nc1ccc(Br)nc1Br |
| InChI | InChI=1S/C5H4Br2N2/c6-4-2-1-3(8)5(7)9-4/h1-2H,8H2 |
| InChIKey | CRTOIQFRVBJJRI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.91 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dibromopyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromopyridin-3-amine?
The IUPAC name of 2,6-dibromopyridin-3-amine (CID 817678) is 2,6-dibromopyridin-3-amine.
What is the SMILES notation for 2,6-dibromopyridin-3-amine?
The canonical SMILES for 2,6-dibromopyridin-3-amine is Nc1ccc(Br)nc1Br.
What is the InChIKey of 2,6-dibromopyridin-3-amine?
The InChIKey is CRTOIQFRVBJJRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Br2N2/c6-4-2-1-3(8)5(7)9-4/h1-2H,8H2.
What are the key properties of 2,6-dibromopyridin-3-amine?
2,6-dibromopyridin-3-amine has a molecular weight of 251.91 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromopyridin-3-amine is sourced from PubChem (CID 817678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).