About 2-piperidin-1-ylpyridine
2-piperidin-1-ylpyridine (PubChem CID 817759) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-piperidin-1-ylpyridine.
Molecular Properties
| Compound Name | 2-piperidin-1-ylpyridine |
| PubChem CID | 817759 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-piperidin-1-ylpyridine |
| SMILES | c1ccc(N2CCCCC2)nc1 |
| InChI | InChI=1S/C10H14N2/c1-4-8-12(9-5-1)10-6-2-3-7-11-10/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | AJEUJXWLOADTKA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-piperidin-1-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylpyridine?
The IUPAC name of 2-piperidin-1-ylpyridine (CID 817759) is 2-piperidin-1-ylpyridine.
What is the SMILES notation for 2-piperidin-1-ylpyridine?
The canonical SMILES for 2-piperidin-1-ylpyridine is c1ccc(N2CCCCC2)nc1.
What is the InChIKey of 2-piperidin-1-ylpyridine?
The InChIKey is AJEUJXWLOADTKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-4-8-12(9-5-1)10-6-2-3-7-11-10/h2-3,6-7H,1,4-5,8-9H2.
What are the key properties of 2-piperidin-1-ylpyridine?
2-piperidin-1-ylpyridine has a molecular weight of 162.24 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylpyridine is sourced from PubChem (CID 817759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).