About 2-(4-cyanoanilino)acetic acid
2-(4-cyanoanilino)acetic acid (PubChem CID 817965) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-(4-cyanoanilino)acetic acid.
Molecular Properties
| Compound Name | 2-(4-cyanoanilino)acetic acid |
| PubChem CID | 817965 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2-(4-cyanoanilino)acetic acid |
| SMILES | N#Cc1ccc(NCC(=O)O)cc1 |
| InChI | InChI=1S/C9H8N2O2/c10-5-7-1-3-8(4-2-7)11-6-9(12)13/h1-4,11H,6H2,(H,12,13) |
| InChIKey | KJRQMXRCZULRHF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-cyanoanilino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyanoanilino)acetic acid?
The IUPAC name of 2-(4-cyanoanilino)acetic acid (CID 817965) is 2-(4-cyanoanilino)acetic acid.
What is the SMILES notation for 2-(4-cyanoanilino)acetic acid?
The canonical SMILES for 2-(4-cyanoanilino)acetic acid is N#Cc1ccc(NCC(=O)O)cc1.
What is the InChIKey of 2-(4-cyanoanilino)acetic acid?
The InChIKey is KJRQMXRCZULRHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c10-5-7-1-3-8(4-2-7)11-6-9(12)13/h1-4,11H,6H2,(H,12,13).
What are the key properties of 2-(4-cyanoanilino)acetic acid?
2-(4-cyanoanilino)acetic acid has a molecular weight of 176.17 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyanoanilino)acetic acid is sourced from PubChem (CID 817965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).