2-(4-cyanoanilino)acetic acid

C9H8N2O2 — CID 817965

IUPAC2-(4-cyanoanilino)acetic acid
SMILESN#Cc1ccc(NCC(=O)O)cc1
InChIInChI=1S/C9H8N2O2/c10-5-7-1-3-8(4-2-7)11-6-9(12)13/h1-4,11H,6H2,(H,12,13)
InChIKeyKJRQMXRCZULRHF-UHFFFAOYSA-N
MW176.17 g/mol
LogP1.05
Rot. Bonds3

About 2-(4-cyanoanilino)acetic acid

2-(4-cyanoanilino)acetic acid (PubChem CID 817965) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-(4-cyanoanilino)acetic acid.

Molecular Properties

Compound Name2-(4-cyanoanilino)acetic acid
PubChem CID817965
Molecular FormulaC9H8N2O2
Molecular Weight176.17 g/mol
Exact Mass176.06
IUPAC Name2-(4-cyanoanilino)acetic acid
SMILESN#Cc1ccc(NCC(=O)O)cc1
InChIInChI=1S/C9H8N2O2/c10-5-7-1-3-8(4-2-7)11-6-9(12)13/h1-4,11H,6H2,(H,12,13)
InChIKeyKJRQMXRCZULRHF-UHFFFAOYSA-N
XLogP1.05
TPSA73.12 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(4-cyanoanilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-cyanoanilino)acetic acid?
The IUPAC name of 2-(4-cyanoanilino)acetic acid (CID 817965) is 2-(4-cyanoanilino)acetic acid.
What is the SMILES notation for 2-(4-cyanoanilino)acetic acid?
The canonical SMILES for 2-(4-cyanoanilino)acetic acid is N#Cc1ccc(NCC(=O)O)cc1.
What is the InChIKey of 2-(4-cyanoanilino)acetic acid?
The InChIKey is KJRQMXRCZULRHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c10-5-7-1-3-8(4-2-7)11-6-9(12)13/h1-4,11H,6H2,(H,12,13).
What are the key properties of 2-(4-cyanoanilino)acetic acid?
2-(4-cyanoanilino)acetic acid has a molecular weight of 176.17 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyanoanilino)acetic acid is sourced from PubChem (CID 817965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).