About 3H-2-benzothiophen-1-one
3H-2-benzothiophen-1-one (PubChem CID 818016) has the molecular formula C8H6OS
and a molecular weight of 150.20 g/mol. Its IUPAC name is 3H-2-benzothiophen-1-one.
Molecular Properties
| Compound Name | 3H-2-benzothiophen-1-one |
| PubChem CID | 818016 |
| Molecular Formula | C8H6OS |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | 3H-2-benzothiophen-1-one |
| SMILES | O=C1SCc2ccccc21 |
| InChI | InChI=1S/C8H6OS/c9-8-7-4-2-1-3-6(7)5-10-8/h1-4H,5H2 |
| InChIKey | NSSBUSDEHNCUIY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3H-2-benzothiophen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-2-benzothiophen-1-one?
The IUPAC name of 3H-2-benzothiophen-1-one (CID 818016) is 3H-2-benzothiophen-1-one.
What is the SMILES notation for 3H-2-benzothiophen-1-one?
The canonical SMILES for 3H-2-benzothiophen-1-one is O=C1SCc2ccccc21.
What is the InChIKey of 3H-2-benzothiophen-1-one?
The InChIKey is NSSBUSDEHNCUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6OS/c9-8-7-4-2-1-3-6(7)5-10-8/h1-4H,5H2.
What are the key properties of 3H-2-benzothiophen-1-one?
3H-2-benzothiophen-1-one has a molecular weight of 150.20 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-2-benzothiophen-1-one is sourced from PubChem (CID 818016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).