About 5-chloropyridin-3-amine
5-chloropyridin-3-amine (PubChem CID 818257) has the molecular formula C5H5ClN2
and a molecular weight of 128.56 g/mol. Its IUPAC name is 5-chloropyridin-3-amine.
Molecular Properties
| Compound Name | 5-chloropyridin-3-amine |
| PubChem CID | 818257 |
| Molecular Formula | C5H5ClN2 |
| Molecular Weight | 128.56 g/mol |
| Exact Mass | 128.01 |
| IUPAC Name | 5-chloropyridin-3-amine |
| SMILES | Nc1cncc(Cl)c1 |
| InChI | InChI=1S/C5H5ClN2/c6-4-1-5(7)3-8-2-4/h1-3H,7H2 |
| InChIKey | ZHMASVAJFJFFLS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.56 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloropyridin-3-amine?
The IUPAC name of 5-chloropyridin-3-amine (CID 818257) is 5-chloropyridin-3-amine.
What is the SMILES notation for 5-chloropyridin-3-amine?
The canonical SMILES for 5-chloropyridin-3-amine is Nc1cncc(Cl)c1.
What is the InChIKey of 5-chloropyridin-3-amine?
The InChIKey is ZHMASVAJFJFFLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2/c6-4-1-5(7)3-8-2-4/h1-3H,7H2.
What are the key properties of 5-chloropyridin-3-amine?
5-chloropyridin-3-amine has a molecular weight of 128.56 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloropyridin-3-amine is sourced from PubChem (CID 818257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).