C13H12Cl3N3O2 — CID 818335
2,2,2-trichloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide (PubChem CID 818335) has the molecular formula C13H12Cl3N3O2 and a molecular weight of 348.62 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 818335 |
| Molecular Formula | C13H12Cl3N3O2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 2,2,2-trichloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide |
| SMILES | Cc1c(NC(=O)C(Cl)(Cl)Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C13H12Cl3N3O2/c1-8-10(17-12(21)13(14,15)16)11(20)19(18(8)2)9-6-4-3-5-7-9/h3-7H,1-2H3,(H,17,21) |
| InChIKey | SYMDVHPUAWGGHG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|