About methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate
methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate (PubChem CID 818638) has the molecular formula C11H12N2O2S
and a molecular weight of 236.30 g/mol. Its IUPAC name is methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate |
| PubChem CID | 818638 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc(C)cc(C)c1C#N |
| InChI | InChI=1S/C11H12N2O2S/c1-7-4-8(2)13-11(9(7)5-12)16-6-10(14)15-3/h4H,6H2,1-3H3 |
| InChIKey | MWFISKSDSYULNM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate?
The IUPAC name of methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate (CID 818638) is methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate.
What is the SMILES notation for methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate?
The canonical SMILES for methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate is COC(=O)CSc1nc(C)cc(C)c1C#N.
What is the InChIKey of methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate?
The InChIKey is MWFISKSDSYULNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S/c1-7-4-8(2)13-11(9(7)5-12)16-6-10(14)15-3/h4H,6H2,1-3H3.
What are the key properties of methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate?
methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate has a molecular weight of 236.30 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate is sourced from PubChem (CID 818638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).