C13H12FNO — CID 818778
1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 818778) has the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde.
| Compound Name | 1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 818778 |
| Molecular Formula | C13H12FNO |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | Cc1cc(C=O)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C13H12FNO/c1-9-7-11(8-16)10(2)15(9)13-6-4-3-5-12(13)14/h3-8H,1-2H3 |
| InChIKey | AWMIXYYZKHFFFW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|