About thieno[2,3-c][2,6]naphthyridine
thieno[2,3-c][2,6]naphthyridine (PubChem CID 818823) has the molecular formula C10H6N2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is thieno[2,3-c][2,6]naphthyridine.
Molecular Properties
| Compound Name | thieno[2,3-c][2,6]naphthyridine |
| PubChem CID | 818823 |
| Molecular Formula | C10H6N2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | thieno[2,3-c][2,6]naphthyridine |
| SMILES | c1cc2cnc3sccc3c2cn1 |
| InChI | InChI=1S/C10H6N2S/c1-3-11-6-9-7(1)5-12-10-8(9)2-4-13-10/h1-6H |
| InChIKey | VATAXIZKQYLONB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[2,3-c][2,6]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-c][2,6]naphthyridine?
The IUPAC name of thieno[2,3-c][2,6]naphthyridine (CID 818823) is thieno[2,3-c][2,6]naphthyridine.
What is the SMILES notation for thieno[2,3-c][2,6]naphthyridine?
The canonical SMILES for thieno[2,3-c][2,6]naphthyridine is c1cc2cnc3sccc3c2cn1.
What is the InChIKey of thieno[2,3-c][2,6]naphthyridine?
The InChIKey is VATAXIZKQYLONB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2S/c1-3-11-6-9-7(1)5-12-10-8(9)2-4-13-10/h1-6H.
What are the key properties of thieno[2,3-c][2,6]naphthyridine?
thieno[2,3-c][2,6]naphthyridine has a molecular weight of 186.24 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-c][2,6]naphthyridine is sourced from PubChem (CID 818823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).