About 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine
5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine (PubChem CID 818851) has the molecular formula C12H19BrN2O2
and a molecular weight of 303.20 g/mol. Its IUPAC name is 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine.
Molecular Properties
| Compound Name | 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine |
| PubChem CID | 818851 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine |
| SMILES | CC(C)(C)Oc1ncc(Br)c(OC(C)(C)C)n1 |
| InChI | InChI=1S/C12H19BrN2O2/c1-11(2,3)16-9-8(13)7-14-10(15-9)17-12(4,5)6/h7H,1-6H3 |
| InChIKey | MAWUVEDTRZARNC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine?
The IUPAC name of 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine (CID 818851) is 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine.
What is the SMILES notation for 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine?
The canonical SMILES for 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine is CC(C)(C)Oc1ncc(Br)c(OC(C)(C)C)n1.
What is the InChIKey of 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine?
The InChIKey is MAWUVEDTRZARNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BrN2O2/c1-11(2,3)16-9-8(13)7-14-10(15-9)17-12(4,5)6/h7H,1-6H3.
What are the key properties of 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine?
5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine has a molecular weight of 303.20 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine is sourced from PubChem (CID 818851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).