About thieno[2,3-c]pyrrole-4,6-dione
thieno[2,3-c]pyrrole-4,6-dione (PubChem CID 818871) has the molecular formula C6H3NO2S
and a molecular weight of 153.16 g/mol. Its IUPAC name is thieno[2,3-c]pyrrole-4,6-dione.
Molecular Properties
| Compound Name | thieno[2,3-c]pyrrole-4,6-dione |
| PubChem CID | 818871 |
| Molecular Formula | C6H3NO2S |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 152.99 |
| IUPAC Name | thieno[2,3-c]pyrrole-4,6-dione |
| SMILES | O=C1NC(=O)c2sccc21 |
| InChI | InChI=1S/C6H3NO2S/c8-5-3-1-2-10-4(3)6(9)7-5/h1-2H,(H,7,8,9) |
| InChIKey | OSEFDTSYKYIFNC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze thieno[2,3-c]pyrrole-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-c]pyrrole-4,6-dione?
The IUPAC name of thieno[2,3-c]pyrrole-4,6-dione (CID 818871) is thieno[2,3-c]pyrrole-4,6-dione.
What is the SMILES notation for thieno[2,3-c]pyrrole-4,6-dione?
The canonical SMILES for thieno[2,3-c]pyrrole-4,6-dione is O=C1NC(=O)c2sccc21.
What is the InChIKey of thieno[2,3-c]pyrrole-4,6-dione?
The InChIKey is OSEFDTSYKYIFNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3NO2S/c8-5-3-1-2-10-4(3)6(9)7-5/h1-2H,(H,7,8,9).
What are the key properties of thieno[2,3-c]pyrrole-4,6-dione?
thieno[2,3-c]pyrrole-4,6-dione has a molecular weight of 153.16 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-c]pyrrole-4,6-dione is sourced from PubChem (CID 818871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).