C18H11N3O2 — CID 818905
17-amino-18-hydroxy-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12,14,16(20),17-nonaen-11-one (PubChem CID 818905) has the molecular formula C18H11N3O2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 17-amino-18-hydroxy-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12,14,16(20),17-nonaen-11-one.
| Compound Name | 17-amino-18-hydroxy-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12,14,16(20),17-nonaen-11-one |
|---|---|
| PubChem CID | 818905 |
| Molecular Formula | C18H11N3O2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 17-amino-18-hydroxy-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12,14,16(20),17-nonaen-11-one |
| SMILES | Nc1c(O)cc2c3c1cccc3c(=O)n1c3ccccc3nc21 |
| InChI | InChI=1S/C18H11N3O2/c19-16-9-4-3-5-10-15(9)11(8-14(16)22)17-20-12-6-1-2-7-13(12)21(17)18(10)23/h1-8,22H,19H2 |
| InChIKey | MVVONFLQDZGRSB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|