3-(2,5-dibromothiophen-3-yl)propanoic acid

C7H6Br2O2S — CID 818919

IUPAC3-(2,5-dibromothiophen-3-yl)propanoic acid
SMILESO=C(O)CCc1cc(Br)sc1Br
InChIInChI=1S/C7H6Br2O2S/c8-5-3-4(7(9)12-5)1-2-6(10)11/h3H,1-2H2,(H,10,11)
InChIKeyNQBVJBLOBCBRDY-UHFFFAOYSA-N
MW314.00 g/mol
LogP3.29
Rot. Bonds3

About 3-(2,5-dibromothiophen-3-yl)propanoic acid

3-(2,5-dibromothiophen-3-yl)propanoic acid (PubChem CID 818919) has the molecular formula C7H6Br2O2S and a molecular weight of 314.00 g/mol. Its IUPAC name is 3-(2,5-dibromothiophen-3-yl)propanoic acid.

Molecular Properties

Compound Name3-(2,5-dibromothiophen-3-yl)propanoic acid
PubChem CID818919
Molecular FormulaC7H6Br2O2S
Molecular Weight314.00 g/mol
Exact Mass311.85
IUPAC Name3-(2,5-dibromothiophen-3-yl)propanoic acid
SMILESO=C(O)CCc1cc(Br)sc1Br
InChIInChI=1S/C7H6Br2O2S/c8-5-3-4(7(9)12-5)1-2-6(10)11/h3H,1-2H2,(H,10,11)
InChIKeyNQBVJBLOBCBRDY-UHFFFAOYSA-N
XLogP3.29
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.00
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2,5-dibromothiophen-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-dibromothiophen-3-yl)propanoic acid?
The IUPAC name of 3-(2,5-dibromothiophen-3-yl)propanoic acid (CID 818919) is 3-(2,5-dibromothiophen-3-yl)propanoic acid.
What is the SMILES notation for 3-(2,5-dibromothiophen-3-yl)propanoic acid?
The canonical SMILES for 3-(2,5-dibromothiophen-3-yl)propanoic acid is O=C(O)CCc1cc(Br)sc1Br.
What is the InChIKey of 3-(2,5-dibromothiophen-3-yl)propanoic acid?
The InChIKey is NQBVJBLOBCBRDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Br2O2S/c8-5-3-4(7(9)12-5)1-2-6(10)11/h3H,1-2H2,(H,10,11).
What are the key properties of 3-(2,5-dibromothiophen-3-yl)propanoic acid?
3-(2,5-dibromothiophen-3-yl)propanoic acid has a molecular weight of 314.00 g/mol, XLogP of 3.29, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dibromothiophen-3-yl)propanoic acid is sourced from PubChem (CID 818919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).