4,5-dimethylthiophene-3-carboxylic acid

C7H8O2S — CID 818943

IUPAC4,5-dimethylthiophene-3-carboxylic acid
SMILESCc1scc(C(=O)O)c1C
InChIInChI=1S/C7H8O2S/c1-4-5(2)10-3-6(4)7(8)9/h3H,1-2H3,(H,8,9)
InChIKeyMETLBUIFJAMVMV-UHFFFAOYSA-N
MW156.21 g/mol
LogP2.06
Rot. Bonds1

About 4,5-dimethylthiophene-3-carboxylic acid

4,5-dimethylthiophene-3-carboxylic acid (PubChem CID 818943) has the molecular formula C7H8O2S and a molecular weight of 156.21 g/mol. Its IUPAC name is 4,5-dimethylthiophene-3-carboxylic acid.

Molecular Properties

Compound Name4,5-dimethylthiophene-3-carboxylic acid
PubChem CID818943
Molecular FormulaC7H8O2S
Molecular Weight156.21 g/mol
Exact Mass156.02
IUPAC Name4,5-dimethylthiophene-3-carboxylic acid
SMILESCc1scc(C(=O)O)c1C
InChIInChI=1S/C7H8O2S/c1-4-5(2)10-3-6(4)7(8)9/h3H,1-2H3,(H,8,9)
InChIKeyMETLBUIFJAMVMV-UHFFFAOYSA-N
XLogP2.06
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.21
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4,5-dimethylthiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dimethylthiophene-3-carboxylic acid?
The IUPAC name of 4,5-dimethylthiophene-3-carboxylic acid (CID 818943) is 4,5-dimethylthiophene-3-carboxylic acid.
What is the SMILES notation for 4,5-dimethylthiophene-3-carboxylic acid?
The canonical SMILES for 4,5-dimethylthiophene-3-carboxylic acid is Cc1scc(C(=O)O)c1C.
What is the InChIKey of 4,5-dimethylthiophene-3-carboxylic acid?
The InChIKey is METLBUIFJAMVMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S/c1-4-5(2)10-3-6(4)7(8)9/h3H,1-2H3,(H,8,9).
What are the key properties of 4,5-dimethylthiophene-3-carboxylic acid?
4,5-dimethylthiophene-3-carboxylic acid has a molecular weight of 156.21 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethylthiophene-3-carboxylic acid is sourced from PubChem (CID 818943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).