About 4-thiophen-3-ylpyridine
4-thiophen-3-ylpyridine (PubChem CID 819002) has the molecular formula C9H7NS
and a molecular weight of 161.23 g/mol. Its IUPAC name is 4-thiophen-3-ylpyridine.
Molecular Properties
| Compound Name | 4-thiophen-3-ylpyridine |
| PubChem CID | 819002 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 4-thiophen-3-ylpyridine |
| SMILES | c1cc(-c2ccsc2)ccn1 |
| InChI | InChI=1S/C9H7NS/c1-4-10-5-2-8(1)9-3-6-11-7-9/h1-7H |
| InChIKey | HVPPTNADZDAEQR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-thiophen-3-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-3-ylpyridine?
The IUPAC name of 4-thiophen-3-ylpyridine (CID 819002) is 4-thiophen-3-ylpyridine.
What is the SMILES notation for 4-thiophen-3-ylpyridine?
The canonical SMILES for 4-thiophen-3-ylpyridine is c1cc(-c2ccsc2)ccn1.
What is the InChIKey of 4-thiophen-3-ylpyridine?
The InChIKey is HVPPTNADZDAEQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS/c1-4-10-5-2-8(1)9-3-6-11-7-9/h1-7H.
What are the key properties of 4-thiophen-3-ylpyridine?
4-thiophen-3-ylpyridine has a molecular weight of 161.23 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-3-ylpyridine is sourced from PubChem (CID 819002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).