About 9-bromothieno[2,3-c][1,5]naphthyridine
9-bromothieno[2,3-c][1,5]naphthyridine (PubChem CID 819130) has the molecular formula C10H5BrN2S
and a molecular weight of 265.13 g/mol. Its IUPAC name is 9-bromothieno[2,3-c][1,5]naphthyridine.
Molecular Properties
| Compound Name | 9-bromothieno[2,3-c][1,5]naphthyridine |
| PubChem CID | 819130 |
| Molecular Formula | C10H5BrN2S |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 263.94 |
| IUPAC Name | 9-bromothieno[2,3-c][1,5]naphthyridine |
| SMILES | Brc1csc2cnc3cccnc3c12 |
| InChI | InChI=1S/C10H5BrN2S/c11-6-5-14-8-4-13-7-2-1-3-12-10(7)9(6)8/h1-5H |
| InChIKey | AXARZWCHUCXWIA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-bromothieno[2,3-c][1,5]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromothieno[2,3-c][1,5]naphthyridine?
The IUPAC name of 9-bromothieno[2,3-c][1,5]naphthyridine (CID 819130) is 9-bromothieno[2,3-c][1,5]naphthyridine.
What is the SMILES notation for 9-bromothieno[2,3-c][1,5]naphthyridine?
The canonical SMILES for 9-bromothieno[2,3-c][1,5]naphthyridine is Brc1csc2cnc3cccnc3c12.
What is the InChIKey of 9-bromothieno[2,3-c][1,5]naphthyridine?
The InChIKey is AXARZWCHUCXWIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrN2S/c11-6-5-14-8-4-13-7-2-1-3-12-10(7)9(6)8/h1-5H.
What are the key properties of 9-bromothieno[2,3-c][1,5]naphthyridine?
9-bromothieno[2,3-c][1,5]naphthyridine has a molecular weight of 265.13 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromothieno[2,3-c][1,5]naphthyridine is sourced from PubChem (CID 819130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).