About 7,9-dibromothieno[3,4-c][1,5]naphthyridine
7,9-dibromothieno[3,4-c][1,5]naphthyridine (PubChem CID 819144) has the molecular formula C10H4Br2N2S
and a molecular weight of 344.03 g/mol. Its IUPAC name is 7,9-dibromothieno[3,4-c][1,5]naphthyridine.
Molecular Properties
| Compound Name | 7,9-dibromothieno[3,4-c][1,5]naphthyridine |
| PubChem CID | 819144 |
| Molecular Formula | C10H4Br2N2S |
| Molecular Weight | 344.03 g/mol |
| Exact Mass | 341.85 |
| IUPAC Name | 7,9-dibromothieno[3,4-c][1,5]naphthyridine |
| SMILES | Brc1sc(Br)c2c1cnc1cccnc12 |
| InChI | InChI=1S/C10H4Br2N2S/c11-9-5-4-14-6-2-1-3-13-8(6)7(5)10(12)15-9/h1-4H |
| InChIKey | BLDPNTXCDYZARQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.03 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,9-dibromothieno[3,4-c][1,5]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dibromothieno[3,4-c][1,5]naphthyridine?
The IUPAC name of 7,9-dibromothieno[3,4-c][1,5]naphthyridine (CID 819144) is 7,9-dibromothieno[3,4-c][1,5]naphthyridine.
What is the SMILES notation for 7,9-dibromothieno[3,4-c][1,5]naphthyridine?
The canonical SMILES for 7,9-dibromothieno[3,4-c][1,5]naphthyridine is Brc1sc(Br)c2c1cnc1cccnc12.
What is the InChIKey of 7,9-dibromothieno[3,4-c][1,5]naphthyridine?
The InChIKey is BLDPNTXCDYZARQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4Br2N2S/c11-9-5-4-14-6-2-1-3-13-8(6)7(5)10(12)15-9/h1-4H.
What are the key properties of 7,9-dibromothieno[3,4-c][1,5]naphthyridine?
7,9-dibromothieno[3,4-c][1,5]naphthyridine has a molecular weight of 344.03 g/mol, XLogP of 4.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dibromothieno[3,4-c][1,5]naphthyridine is sourced from PubChem (CID 819144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).