About 7H-furo[3,4-b]pyridin-5-one
7H-furo[3,4-b]pyridin-5-one (PubChem CID 819439) has the molecular formula C7H5NO2
and a molecular weight of 135.12 g/mol. Its IUPAC name is 7H-furo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 7H-furo[3,4-b]pyridin-5-one |
| PubChem CID | 819439 |
| Molecular Formula | C7H5NO2 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | 7H-furo[3,4-b]pyridin-5-one |
| SMILES | O=C1OCc2ncccc21 |
| InChI | InChI=1S/C7H5NO2/c9-7-5-2-1-3-8-6(5)4-10-7/h1-3H,4H2 |
| InChIKey | YSJHADWSLVFGGT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7H-furo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-furo[3,4-b]pyridin-5-one?
The IUPAC name of 7H-furo[3,4-b]pyridin-5-one (CID 819439) is 7H-furo[3,4-b]pyridin-5-one.
What is the SMILES notation for 7H-furo[3,4-b]pyridin-5-one?
The canonical SMILES for 7H-furo[3,4-b]pyridin-5-one is O=C1OCc2ncccc21.
What is the InChIKey of 7H-furo[3,4-b]pyridin-5-one?
The InChIKey is YSJHADWSLVFGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2/c9-7-5-2-1-3-8-6(5)4-10-7/h1-3H,4H2.
What are the key properties of 7H-furo[3,4-b]pyridin-5-one?
7H-furo[3,4-b]pyridin-5-one has a molecular weight of 135.12 g/mol, XLogP of 0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-furo[3,4-b]pyridin-5-one is sourced from PubChem (CID 819439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).