About 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide
2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide (PubChem CID 819443) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide.
Molecular Properties
| Compound Name | 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide |
| PubChem CID | 819443 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide |
| SMILES | Cc1oc2cc(C(=O)NN)[nH]c2c1C |
| InChI | InChI=1S/C9H11N3O2/c1-4-5(2)14-7-3-6(9(13)12-10)11-8(4)7/h3,11H,10H2,1-2H3,(H,12,13) |
| InChIKey | AVRIQFPBXAFHBS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide?
The IUPAC name of 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide (CID 819443) is 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide.
What is the SMILES notation for 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide?
The canonical SMILES for 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide is Cc1oc2cc(C(=O)NN)[nH]c2c1C.
What is the InChIKey of 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide?
The InChIKey is AVRIQFPBXAFHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c1-4-5(2)14-7-3-6(9(13)12-10)11-8(4)7/h3,11H,10H2,1-2H3,(H,12,13).
What are the key properties of 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide?
2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide has a molecular weight of 193.21 g/mol, XLogP of 0.98, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4H-furo[3,2-b]pyrrole-5-carbohydrazide is sourced from PubChem (CID 819443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).