C17H14FN3O2 — CID 819592
2-(4-fluorophenyl)-4-[(2-hydroxyanilino)methylene]-5-methyl-2,4-dihydro-3H-pyrazol-3-one (PubChem CID 819592) has the molecular formula C17H14FN3O2 and a molecular weight of 311.31 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[(2-hydroxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-fluorophenyl)-4-[(2-hydroxyanilino)methylene]-5-methyl-2,4-dihydro-3H-pyrazol-3-one |
|---|---|
| PubChem CID | 819592 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[(2-hydroxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | CC1=C(C(=O)N(N1)C2=CC=C(C=C2)F)C=NC3=CC=CC=C3O |
| InChI | InChI=1S/C17H14FN3O2/c1-11-14(10-19-15-4-2-3-5-16(15)22)17(23)21(20-11)13-8-6-12(18)7-9-13/h2-10,20,22H,1H3 |
| InChIKey | IERPXTLFEJQLRX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | 512 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|