About (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone
(2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 819675) has the molecular formula C15H11Cl2NO
and a molecular weight of 292.17 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone.
Molecular Properties
| Compound Name | (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone |
| PubChem CID | 819675 |
| Molecular Formula | C15H11Cl2NO |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H11Cl2NO/c16-11-5-6-12(13(17)9-11)15(19)18-8-7-10-3-1-2-4-14(10)18/h1-6,9H,7-8H2 |
| InChIKey | XIIJGAJRLXHGBE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone?
The IUPAC name of (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone (CID 819675) is (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone.
What is the SMILES notation for (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone?
The canonical SMILES for (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone is O=C(c1ccc(Cl)cc1Cl)N1CCc2ccccc21.
What is the InChIKey of (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone?
The InChIKey is XIIJGAJRLXHGBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2NO/c16-11-5-6-12(13(17)9-11)15(19)18-8-7-10-3-1-2-4-14(10)18/h1-6,9H,7-8H2.
What are the key properties of (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone?
(2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone has a molecular weight of 292.17 g/mol, XLogP of 4.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone is sourced from PubChem (CID 819675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).