About 5-(methoxymethyl)-1,2-dihydropyrazol-3-one
5-(methoxymethyl)-1,2-dihydropyrazol-3-one (PubChem CID 819709) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 5-(methoxymethyl)-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-1,2-dihydropyrazol-3-one |
| PubChem CID | 819709 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 5-(methoxymethyl)-1,2-dihydropyrazol-3-one |
| SMILES | COCc1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C5H8N2O2/c1-9-3-4-2-5(8)7-6-4/h2H,3H2,1H3,(H2,6,7,8) |
| InChIKey | CJIPHLPKQMKKIT-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(methoxymethyl)-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-(methoxymethyl)-1,2-dihydropyrazol-3-one (CID 819709) is 5-(methoxymethyl)-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-(methoxymethyl)-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-(methoxymethyl)-1,2-dihydropyrazol-3-one is COCc1cc(=O)[nH][nH]1.
What is the InChIKey of 5-(methoxymethyl)-1,2-dihydropyrazol-3-one?
The InChIKey is CJIPHLPKQMKKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-9-3-4-2-5(8)7-6-4/h2H,3H2,1H3,(H2,6,7,8).
What are the key properties of 5-(methoxymethyl)-1,2-dihydropyrazol-3-one?
5-(methoxymethyl)-1,2-dihydropyrazol-3-one has a molecular weight of 128.13 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 819709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).