About 7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione
7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione (PubChem CID 81972) has the molecular formula C8H10N4O3
and a molecular weight of 210.19 g/mol. Its IUPAC name is 1,3,9-trimethyl-7H-purine-2,6,8-trione.
Analyze 7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione?
The IUPAC name of 7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione (CID 81972) is 1,3,9-trimethyl-7H-purine-2,6,8-trione.
What is the SMILES notation for 7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione?
The canonical SMILES for 7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione is CN1C2=C(C(=O)N(C(=O)N2C)C)NC1=O.
What is the InChIKey of 7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione?
The InChIKey is CWENCZHQIWXCCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O3/c1-10-5-4(9-7(10)14)6(13)12(3)8(15)11(5)2/h1-3H3,(H,9,14).
What are the key properties of 7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione?
7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione has a molecular weight of 210.19 g/mol, XLogP of -0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione is sourced from PubChem (CID 81972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).