About 6-chloropyridin-3-ol
6-chloropyridin-3-ol (PubChem CID 819821) has the molecular formula C5H4ClNO
and a molecular weight of 129.55 g/mol. Its IUPAC name is 6-chloropyridin-3-ol.
Molecular Properties
| Compound Name | 6-chloropyridin-3-ol |
| PubChem CID | 819821 |
| Molecular Formula | C5H4ClNO |
| Molecular Weight | 129.55 g/mol |
| Exact Mass | 129.00 |
| IUPAC Name | 6-chloropyridin-3-ol |
| SMILES | Oc1ccc(Cl)nc1 |
| InChI | InChI=1S/C5H4ClNO/c6-5-2-1-4(8)3-7-5/h1-3,8H |
| InChIKey | KVCOOWROABTXDJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloropyridin-3-ol?
The IUPAC name of 6-chloropyridin-3-ol (CID 819821) is 6-chloropyridin-3-ol.
What is the SMILES notation for 6-chloropyridin-3-ol?
The canonical SMILES for 6-chloropyridin-3-ol is Oc1ccc(Cl)nc1.
What is the InChIKey of 6-chloropyridin-3-ol?
The InChIKey is KVCOOWROABTXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClNO/c6-5-2-1-4(8)3-7-5/h1-3,8H.
What are the key properties of 6-chloropyridin-3-ol?
6-chloropyridin-3-ol has a molecular weight of 129.55 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloropyridin-3-ol is sourced from PubChem (CID 819821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).