About 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine
6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine (PubChem CID 820005) has the molecular formula C21H18N4O
and a molecular weight of 342.40 g/mol. Its IUPAC name is 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine.
Molecular Properties
| Compound Name | 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine |
| PubChem CID | 820005 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine |
| SMILES | COc1ccc2nc(Nc3ccccc3)c(Nc3ccccc3)nc2c1 |
| InChI | InChI=1S/C21H18N4O/c1-26-17-12-13-18-19(14-17)25-21(23-16-10-6-3-7-11-16)20(24-18)22-15-8-4-2-5-9-15/h2-14H,1H3,(H,22,24)(H,23,25) |
| InChIKey | HCHPSLAKVJZIDG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine?
The IUPAC name of 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine (CID 820005) is 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine.
What is the SMILES notation for 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine?
The canonical SMILES for 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine is COc1ccc2nc(Nc3ccccc3)c(Nc3ccccc3)nc2c1.
What is the InChIKey of 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine?
The InChIKey is HCHPSLAKVJZIDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O/c1-26-17-12-13-18-19(14-17)25-21(23-16-10-6-3-7-11-16)20(24-18)22-15-8-4-2-5-9-15/h2-14H,1H3,(H,22,24)(H,23,25).
What are the key properties of 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine?
6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine has a molecular weight of 342.40 g/mol, XLogP of 5.13, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-N,3-N-diphenylquinoxaline-2,3-diamine is sourced from PubChem (CID 820005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).