C13H15NO4 — CID 82000952
(1R)-1-[4-methoxy-2-(1,2-oxazol-4-ylmethoxy)phenyl]ethanol (PubChem CID 82000952) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (1R)-1-[4-methoxy-2-(1,2-oxazol-4-ylmethoxy)phenyl]ethanol.
| Compound Name | (1R)-1-[4-methoxy-2-(1,2-oxazol-4-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 82000952 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (1R)-1-[4-methoxy-2-(1,2-oxazol-4-ylmethoxy)phenyl]ethanol |
| SMILES | COc1ccc([C@@H](C)O)c(OCc2cnoc2)c1 |
| InChI | InChI=1S/C13H15NO4/c1-9(15)12-4-3-11(16-2)5-13(12)17-7-10-6-14-18-8-10/h3-6,8-9,15H,7H2,1-2H3/t9-/m1/s1 |
| InChIKey | RNSUIBCXNUCGPC-SECBINFHSA-N |
| XLogP | 2.32 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |