About [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine
[1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine (PubChem CID 82000970) has the molecular formula C15H19Cl2N3
and a molecular weight of 312.24 g/mol. Its IUPAC name is [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine |
| PubChem CID | 82000970 |
| Molecular Formula | C15H19Cl2N3 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine |
| SMILES | NCC1(Cc2nc3cc(Cl)c(Cl)cc3[nH]2)CCCCC1 |
| InChI | InChI=1S/C15H19Cl2N3/c16-10-6-12-13(7-11(10)17)20-14(19-12)8-15(9-18)4-2-1-3-5-15/h6-7H,1-5,8-9,18H2,(H,19,20) |
| InChIKey | WDDMDLZVLFNWIZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine?
The IUPAC name of [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine (CID 82000970) is [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine.
What is the SMILES notation for [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine?
The canonical SMILES for [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine is NCC1(Cc2nc3cc(Cl)c(Cl)cc3[nH]2)CCCCC1.
What is the InChIKey of [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine?
The InChIKey is WDDMDLZVLFNWIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2N3/c16-10-6-12-13(7-11(10)17)20-14(19-12)8-15(9-18)4-2-1-3-5-15/h6-7H,1-5,8-9,18H2,(H,19,20).
What are the key properties of [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine?
[1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine has a molecular weight of 312.24 g/mol, XLogP of 4.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]methanamine is sourced from PubChem (CID 82000970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).