C11H14F2O3 — CID 82001163
1-[2-(2,2-difluoroethoxy)-4-methoxyphenyl]ethanol (PubChem CID 82001163) has the molecular formula C11H14F2O3 and a molecular weight of 232.23 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethoxy)-4-methoxyphenyl]ethanol.
| Compound Name | 1-[2-(2,2-difluoroethoxy)-4-methoxyphenyl]ethanol |
|---|---|
| PubChem CID | 82001163 |
| Molecular Formula | C11H14F2O3 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-[2-(2,2-difluoroethoxy)-4-methoxyphenyl]ethanol |
| SMILES | COc1ccc(C(C)O)c(OCC(F)F)c1 |
| InChI | InChI=1S/C11H14F2O3/c1-7(14)9-4-3-8(15-2)5-10(9)16-6-11(12)13/h3-5,7,11,14H,6H2,1-2H3 |
| InChIKey | ZWZHTJMGGVGCCI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |