About 2H-1,4-benzothiazin-3-amine
2H-1,4-benzothiazin-3-amine (PubChem CID 820028) has the molecular formula C8H8N2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 2H-1,4-benzothiazin-3-amine.
Molecular Properties
| Compound Name | 2H-1,4-benzothiazin-3-amine |
| PubChem CID | 820028 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 2H-1,4-benzothiazin-3-amine |
| SMILES | NC1=Nc2ccccc2SC1 |
| InChI | InChI=1S/C8H8N2S/c9-8-5-11-7-4-2-1-3-6(7)10-8/h1-4H,5H2,(H2,9,10) |
| InChIKey | SBZQHWWTOVFQFD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-1,4-benzothiazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,4-benzothiazin-3-amine?
The IUPAC name of 2H-1,4-benzothiazin-3-amine (CID 820028) is 2H-1,4-benzothiazin-3-amine.
What is the SMILES notation for 2H-1,4-benzothiazin-3-amine?
The canonical SMILES for 2H-1,4-benzothiazin-3-amine is NC1=Nc2ccccc2SC1.
What is the InChIKey of 2H-1,4-benzothiazin-3-amine?
The InChIKey is SBZQHWWTOVFQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S/c9-8-5-11-7-4-2-1-3-6(7)10-8/h1-4H,5H2,(H2,9,10).
What are the key properties of 2H-1,4-benzothiazin-3-amine?
2H-1,4-benzothiazin-3-amine has a molecular weight of 164.23 g/mol, XLogP of 1.78, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,4-benzothiazin-3-amine is sourced from PubChem (CID 820028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).