About 7-hydroxy-4H-1,4-benzothiazin-3-one
7-hydroxy-4H-1,4-benzothiazin-3-one (PubChem CID 820031) has the molecular formula C8H7NO2S
and a molecular weight of 181.22 g/mol. Its IUPAC name is 7-hydroxy-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 7-hydroxy-4H-1,4-benzothiazin-3-one |
| PubChem CID | 820031 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 7-hydroxy-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2cc(O)ccc2N1 |
| InChI | InChI=1S/C8H7NO2S/c10-5-1-2-6-7(3-5)12-4-8(11)9-6/h1-3,10H,4H2,(H,9,11) |
| InChIKey | GJRKJMSYGXBCNU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-4H-1,4-benzothiazin-3-one?
The IUPAC name of 7-hydroxy-4H-1,4-benzothiazin-3-one (CID 820031) is 7-hydroxy-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 7-hydroxy-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 7-hydroxy-4H-1,4-benzothiazin-3-one is O=C1CSc2cc(O)ccc2N1.
What is the InChIKey of 7-hydroxy-4H-1,4-benzothiazin-3-one?
The InChIKey is GJRKJMSYGXBCNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S/c10-5-1-2-6-7(3-5)12-4-8(11)9-6/h1-3,10H,4H2,(H,9,11).
What are the key properties of 7-hydroxy-4H-1,4-benzothiazin-3-one?
7-hydroxy-4H-1,4-benzothiazin-3-one has a molecular weight of 181.22 g/mol, XLogP of 1.44, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 820031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).