C12H15F3N2O2S — CID 82003148
1-N-cyclopropyl-3-methylsulfonyl-1-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine (PubChem CID 82003148) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.32 g/mol. Its IUPAC name is 1-N-cyclopropyl-3-methylsulfonyl-1-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine.
| Compound Name | 1-N-cyclopropyl-3-methylsulfonyl-1-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 82003148 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-N-cyclopropyl-3-methylsulfonyl-1-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine |
| SMILES | CS(=O)(=O)c1cccc(N(CC(F)(F)F)C2CC2)c1N |
| InChI | InChI=1S/C12H15F3N2O2S/c1-20(18,19)10-4-2-3-9(11(10)16)17(8-5-6-8)7-12(13,14)15/h2-4,8H,5-7,16H2,1H3 |
| InChIKey | CBKSYPCRMTZXOH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|