About 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide
5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 82003766) has the molecular formula C8H12F2N4O2
and a molecular weight of 234.21 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| PubChem CID | 82003766 |
| Molecular Formula | C8H12F2N4O2 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | Cc1nn(C)c(OCC(F)F)c1C(N)=NO |
| InChI | InChI=1S/C8H12F2N4O2/c1-4-6(7(11)13-15)8(14(2)12-4)16-3-5(9)10/h5,15H,3H2,1-2H3,(H2,11,13) |
| InChIKey | QOQCNNZZZRLCBC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
The IUPAC name of 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (CID 82003766) is 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
What is the SMILES notation for 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
The canonical SMILES for 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide is Cc1nn(C)c(OCC(F)F)c1C(N)=NO.
What is the InChIKey of 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
The InChIKey is QOQCNNZZZRLCBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N4O2/c1-4-6(7(11)13-15)8(14(2)12-4)16-3-5(9)10/h5,15H,3H2,1-2H3,(H2,11,13).
What are the key properties of 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide has a molecular weight of 234.21 g/mol, XLogP of 0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethoxy)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide is sourced from PubChem (CID 82003766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).